C22H12BrClN4O6 — CID 126090203
(E)-3-[5-bromo-2-(2,4-dinitrophenoxy)phenyl]-N-(4-chlorophenyl)-2-cyanoprop-2-enamide (PubChem CID 126090203) has the molecular formula C22H12BrClN4O6 and a molecular weight of 543.72 g/mol. Its IUPAC name is (E)-3-[5-bromo-2-(2,4-dinitrophenoxy)phenyl]-N-(4-chlorophenyl)-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-[5-bromo-2-(2,4-dinitrophenoxy)phenyl]-N-(4-chlorophenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 126090203 |
| Molecular Formula | C22H12BrClN4O6 |
| Molecular Weight | 543.72 g/mol |
| Exact Mass | 541.96 |
| IUPAC Name | (E)-3-[5-bromo-2-(2,4-dinitrophenoxy)phenyl]-N-(4-chlorophenyl)-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C\c1cc(Br)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H12BrClN4O6/c23-15-1-7-20(34-21-8-6-18(27(30)31)11-19(21)28(32)33)13(10-15)9-14(12-25)22(29)26-17-4-2-16(24)3-5-17/h1-11H,(H,26,29)/b14-9+ |
| InChIKey | VVBBHWJAKROKTF-NTEUORMPSA-N |
| XLogP | 6.26 |
| TPSA | 148.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.72 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|