C23H13ClF3N3O4 — CID 126089060
(E)-N-(4-chlorophenyl)-2-cyano-3-[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enamide (PubChem CID 126089060) has the molecular formula C23H13ClF3N3O4 and a molecular weight of 487.82 g/mol. Its IUPAC name is (E)-N-(4-chlorophenyl)-2-cyano-3-[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(4-chlorophenyl)-2-cyano-3-[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126089060 |
| Molecular Formula | C23H13ClF3N3O4 |
| Molecular Weight | 487.82 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | (E)-N-(4-chlorophenyl)-2-cyano-3-[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enamide |
| SMILES | N#C/C(=C\c1ccccc1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-])C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H13ClF3N3O4/c24-17-6-8-18(9-7-17)29-22(31)15(13-28)11-14-3-1-2-4-20(14)34-21-10-5-16(23(25,26)27)12-19(21)30(32)33/h1-12H,(H,29,31)/b15-11+ |
| InChIKey | MUPAXJWZFJLURS-RVDMUPIBSA-N |
| XLogP | 6.60 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.82 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|