C23H12Br2F3N3O5 — CID 126097210
(E)-2-cyano-3-[3,5-dibromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(4-hydroxyphenyl)prop-2-enamide (PubChem CID 126097210) has the molecular formula C23H12Br2F3N3O5 and a molecular weight of 627.17 g/mol. Its IUPAC name is (E)-2-cyano-3-[3,5-dibromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(4-hydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3,5-dibromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126097210 |
| Molecular Formula | C23H12Br2F3N3O5 |
| Molecular Weight | 627.17 g/mol |
| Exact Mass | 624.91 |
| IUPAC Name | (E)-2-cyano-3-[3,5-dibromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(4-hydroxyphenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1cc(Br)c(Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c(Br)c1)C(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C23H12Br2F3N3O5/c24-17-8-12(7-13(11-29)22(33)30-15-2-4-16(32)5-3-15)9-18(25)21(17)36-20-6-1-14(23(26,27)28)10-19(20)31(34)35/h1-10,32H,(H,30,33)/b13-7+ |
| InChIKey | PDGAKNGIOWOUSA-NTUHNPAUSA-N |
| XLogP | 7.18 |
| TPSA | 125.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.17 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|