C25H14Cl2F3N3O6 — CID 126087493
methyl 4-[[(E)-2-cyano-3-[3,5-dichloro-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enoyl]amino]benzoate (PubChem CID 126087493) has the molecular formula C25H14Cl2F3N3O6 and a molecular weight of 580.30 g/mol. Its IUPAC name is methyl 4-[[(E)-2-cyano-3-[3,5-dichloro-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enoyl]amino]benzoate.
| Compound Name | methyl 4-[[(E)-2-cyano-3-[3,5-dichloro-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 126087493 |
| Molecular Formula | C25H14Cl2F3N3O6 |
| Molecular Weight | 580.30 g/mol |
| Exact Mass | 579.02 |
| IUPAC Name | methyl 4-[[(E)-2-cyano-3-[3,5-dichloro-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)/C(C#N)=C/c2cc(Cl)c(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c(Cl)c2)cc1 |
| InChI | InChI=1S/C25H14Cl2F3N3O6/c1-38-24(35)14-2-5-17(6-3-14)32-23(34)15(12-31)8-13-9-18(26)22(19(27)10-13)39-21-7-4-16(25(28,29)30)11-20(21)33(36)37/h2-11H,1H3,(H,32,34)/b15-8+ |
| InChIKey | GIIGKNJDMGYOCV-OVCLIPMQSA-N |
| XLogP | 7.04 |
| TPSA | 131.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.30 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|