C25H16F3N3O6 — CID 126098958
methyl 4-[[(Z)-2-cyano-3-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enoyl]amino]benzoate (PubChem CID 126098958) has the molecular formula C25H16F3N3O6 and a molecular weight of 511.41 g/mol. Its IUPAC name is methyl 4-[[(Z)-2-cyano-3-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enoyl]amino]benzoate.
| Compound Name | methyl 4-[[(Z)-2-cyano-3-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 126098958 |
| Molecular Formula | C25H16F3N3O6 |
| Molecular Weight | 511.41 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | methyl 4-[[(Z)-2-cyano-3-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)/C(C#N)=C\c2cccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C25H16F3N3O6/c1-36-24(33)16-5-8-19(9-6-16)30-23(32)17(14-29)11-15-3-2-4-20(12-15)37-22-10-7-18(25(26,27)28)13-21(22)31(34)35/h2-13H,1H3,(H,30,32)/b17-11- |
| InChIKey | XGMOXWSPPAHMNX-BOPFTXTBSA-N |
| XLogP | 5.74 |
| TPSA | 131.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.41 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|