C25H17F3IN3O6 — CID 126084356
(E)-2-cyano-3-[3-ethoxy-5-iodo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(4-hydroxyphenyl)prop-2-enamide (PubChem CID 126084356) has the molecular formula C25H17F3IN3O6 and a molecular weight of 639.32 g/mol. Its IUPAC name is (E)-2-cyano-3-[3-ethoxy-5-iodo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(4-hydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3-ethoxy-5-iodo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126084356 |
| Molecular Formula | C25H17F3IN3O6 |
| Molecular Weight | 639.32 g/mol |
| Exact Mass | 639.01 |
| IUPAC Name | (E)-2-cyano-3-[3-ethoxy-5-iodo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(4-hydroxyphenyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)Nc2ccc(O)cc2)cc(I)c1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H17F3IN3O6/c1-2-37-22-11-14(9-15(13-30)24(34)31-17-4-6-18(33)7-5-17)10-19(29)23(22)38-21-8-3-16(25(26,27)28)12-20(21)32(35)36/h3-12,33H,2H2,1H3,(H,31,34)/b15-9+ |
| InChIKey | GGKUZDXLIZSKES-OQLLNIDSSA-N |
| XLogP | 6.66 |
| TPSA | 134.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.32 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|