C26H21ClN4O8 — CID 126085776
(E)-3-[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-2-cyano-N-(4-ethoxyphenyl)prop-2-enamide (PubChem CID 126085776) has the molecular formula C26H21ClN4O8 and a molecular weight of 552.93 g/mol. Its IUPAC name is (E)-3-[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-2-cyano-N-(4-ethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-2-cyano-N-(4-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126085776 |
| Molecular Formula | C26H21ClN4O8 |
| Molecular Weight | 552.93 g/mol |
| Exact Mass | 552.10 |
| IUPAC Name | (E)-3-[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-2-cyano-N-(4-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(NC(=O)/C(C#N)=C/c2cc(Cl)c(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(OCC)c2)cc1 |
| InChI | InChI=1S/C26H21ClN4O8/c1-3-37-20-8-5-18(6-9-20)29-26(32)17(15-28)11-16-12-21(27)25(24(13-16)38-4-2)39-23-10-7-19(30(33)34)14-22(23)31(35)36/h5-14H,3-4H2,1-2H3,(H,29,32)/b17-11+ |
| InChIKey | FTIRGIXERCFTDG-GZTJUZNOSA-N |
| XLogP | 6.29 |
| TPSA | 166.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.93 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|