C24H16BrFN4O7 — CID 4095705
3-[3-bromo-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-2-cyano-N-(4-fluorophenyl)prop-2-enamide (PubChem CID 4095705) has the molecular formula C24H16BrFN4O7 and a molecular weight of 571.32 g/mol. Its IUPAC name is 3-[3-bromo-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-2-cyano-N-(4-fluorophenyl)prop-2-enamide.
| Compound Name | 3-[3-bromo-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-2-cyano-N-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4095705 |
| Molecular Formula | C24H16BrFN4O7 |
| Molecular Weight | 571.32 g/mol |
| Exact Mass | 570.02 |
| IUPAC Name | 3-[3-bromo-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-2-cyano-N-(4-fluorophenyl)prop-2-enamide |
| SMILES | CCOc1cc(C=C(C#N)C(=O)Nc2ccc(F)cc2)cc(Br)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H16BrFN4O7/c1-2-36-22-11-14(9-15(13-27)24(31)28-17-5-3-16(26)4-6-17)10-19(25)23(22)37-21-8-7-18(29(32)33)12-20(21)30(34)35/h3-12H,2H2,1H3,(H,28,31) |
| InChIKey | DLHQCAPZLSQUHH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 157.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.32 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|