C27H21FN4O7 — CID 126089983
(E)-2-cyano-3-[4-(2,4-dinitrophenoxy)-3-ethoxy-5-prop-2-enylphenyl]-N-(4-fluorophenyl)prop-2-enamide (PubChem CID 126089983) has the molecular formula C27H21FN4O7 and a molecular weight of 532.48 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-(2,4-dinitrophenoxy)-3-ethoxy-5-prop-2-enylphenyl]-N-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[4-(2,4-dinitrophenoxy)-3-ethoxy-5-prop-2-enylphenyl]-N-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126089983 |
| Molecular Formula | C27H21FN4O7 |
| Molecular Weight | 532.48 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | (E)-2-cyano-3-[4-(2,4-dinitrophenoxy)-3-ethoxy-5-prop-2-enylphenyl]-N-(4-fluorophenyl)prop-2-enamide |
| SMILES | C=CCc1cc(/C=C(\C#N)C(=O)Nc2ccc(F)cc2)cc(OCC)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H21FN4O7/c1-3-5-18-12-17(13-19(16-29)27(33)30-21-8-6-20(28)7-9-21)14-25(38-4-2)26(18)39-24-11-10-22(31(34)35)15-23(24)32(36)37/h3,6-15H,1,4-5H2,2H3,(H,30,33)/b19-13+ |
| InChIKey | VOBIYNLLQNUICY-CPNJWEJPSA-N |
| XLogP | 6.11 |
| TPSA | 157.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.48 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|