C28H25N3O6 — CID 5039681
2-cyano-3-[3-ethoxy-4-[(3-nitrophenyl)methoxy]-5-prop-2-enylphenyl]-N-(4-hydroxyphenyl)prop-2-enamide (PubChem CID 5039681) has the molecular formula C28H25N3O6 and a molecular weight of 499.52 g/mol. Its IUPAC name is 2-cyano-3-[3-ethoxy-4-[(3-nitrophenyl)methoxy]-5-prop-2-enylphenyl]-N-(4-hydroxyphenyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[3-ethoxy-4-[(3-nitrophenyl)methoxy]-5-prop-2-enylphenyl]-N-(4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 5039681 |
| Molecular Formula | C28H25N3O6 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 2-cyano-3-[3-ethoxy-4-[(3-nitrophenyl)methoxy]-5-prop-2-enylphenyl]-N-(4-hydroxyphenyl)prop-2-enamide |
| SMILES | C=CCc1cc(C=C(C#N)C(=O)Nc2ccc(O)cc2)cc(OCC)c1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H25N3O6/c1-3-6-21-13-20(14-22(17-29)28(33)30-23-9-11-25(32)12-10-23)16-26(36-4-2)27(21)37-18-19-7-5-8-24(15-19)31(34)35/h3,5,7-16,32H,1,4,6,18H2,2H3,(H,30,33) |
| InChIKey | WQAMNWHNXNNVCR-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 134.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|