C30H29N3O6 — CID 4141683
2-cyano-3-[3-ethoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]-N-[(4-methoxyphenyl)methyl]prop-2-enamide (PubChem CID 4141683) has the molecular formula C30H29N3O6 and a molecular weight of 527.58 g/mol. Its IUPAC name is 2-cyano-3-[3-ethoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]-N-[(4-methoxyphenyl)methyl]prop-2-enamide.
| Compound Name | 2-cyano-3-[3-ethoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]-N-[(4-methoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 4141683 |
| Molecular Formula | C30H29N3O6 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | 2-cyano-3-[3-ethoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]-N-[(4-methoxyphenyl)methyl]prop-2-enamide |
| SMILES | C=CCc1cc(C=C(C#N)C(=O)NCc2ccc(OC)cc2)cc(OCC)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H29N3O6/c1-4-6-24-15-23(16-25(18-31)30(34)32-19-21-9-13-27(37-3)14-10-21)17-28(38-5-2)29(24)39-20-22-7-11-26(12-8-22)33(35)36/h4,7-17H,1,5-6,19-20H2,2-3H3,(H,32,34) |
| InChIKey | XOTWUOIXOZMBAG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 123.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|