C22H23BrN2O4 — CID 124646674
(Z)-3-(3-bromo-4,5-diethoxyphenyl)-2-cyano-N-[(4-methoxyphenyl)methyl]prop-2-enamide (PubChem CID 124646674) has the molecular formula C22H23BrN2O4 and a molecular weight of 459.34 g/mol. Its IUPAC name is (Z)-3-(3-bromo-4,5-diethoxyphenyl)-2-cyano-N-[(4-methoxyphenyl)methyl]prop-2-enamide.
| Compound Name | (Z)-3-(3-bromo-4,5-diethoxyphenyl)-2-cyano-N-[(4-methoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 124646674 |
| Molecular Formula | C22H23BrN2O4 |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | (Z)-3-(3-bromo-4,5-diethoxyphenyl)-2-cyano-N-[(4-methoxyphenyl)methyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)NCc2ccc(OC)cc2)cc(Br)c1OCC |
| InChI | InChI=1S/C22H23BrN2O4/c1-4-28-20-12-16(11-19(23)21(20)29-5-2)10-17(13-24)22(26)25-14-15-6-8-18(27-3)9-7-15/h6-12H,4-5,14H2,1-3H3,(H,25,26)/b17-10- |
| InChIKey | PEBIPEIPSAAYBH-YVLHZVERSA-N |
| XLogP | 4.48 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|