C27H23ClN2O5 — CID 17277714
[4-[(E)-2-cyano-3-[(4-methoxyphenyl)methylamino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] 2-chlorobenzoate (PubChem CID 17277714) has the molecular formula C27H23ClN2O5 and a molecular weight of 490.94 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-[(4-methoxyphenyl)methylamino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] 2-chlorobenzoate.
| Compound Name | [4-[(E)-2-cyano-3-[(4-methoxyphenyl)methylamino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 17277714 |
| Molecular Formula | C27H23ClN2O5 |
| Molecular Weight | 490.94 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | [4-[(E)-2-cyano-3-[(4-methoxyphenyl)methylamino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] 2-chlorobenzoate |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)NCc2ccc(OC)cc2)ccc1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C27H23ClN2O5/c1-3-34-25-15-19(10-13-24(25)35-27(32)22-6-4-5-7-23(22)28)14-20(16-29)26(31)30-17-18-8-11-21(33-2)12-9-18/h4-15H,3,17H2,1-2H3,(H,30,31)/b20-14+ |
| InChIKey | YFMWPRPDZPMTAY-XSFVSMFZSA-N |
| XLogP | 5.19 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.94 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|