C24H16Br2N4O7 — CID 126098564
(E)-2-cyano-3-[3,5-dibromo-2-(2,4-dinitrophenoxy)phenyl]-N-(4-ethoxyphenyl)prop-2-enamide (PubChem CID 126098564) has the molecular formula C24H16Br2N4O7 and a molecular weight of 632.22 g/mol. Its IUPAC name is (E)-2-cyano-3-[3,5-dibromo-2-(2,4-dinitrophenoxy)phenyl]-N-(4-ethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3,5-dibromo-2-(2,4-dinitrophenoxy)phenyl]-N-(4-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126098564 |
| Molecular Formula | C24H16Br2N4O7 |
| Molecular Weight | 632.22 g/mol |
| Exact Mass | 629.94 |
| IUPAC Name | (E)-2-cyano-3-[3,5-dibromo-2-(2,4-dinitrophenoxy)phenyl]-N-(4-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(NC(=O)/C(C#N)=C/c2cc(Br)cc(Br)c2Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H16Br2N4O7/c1-2-36-19-6-3-17(4-7-19)28-24(31)15(13-27)9-14-10-16(25)11-20(26)23(14)37-22-8-5-18(29(32)33)12-21(22)30(34)35/h3-12H,2H2,1H3,(H,28,31)/b15-9+ |
| InChIKey | TVLDLSHCGNDLMJ-OQLLNIDSSA-N |
| XLogP | 6.76 |
| TPSA | 157.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.22 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|