C19H15Br2N3O4 — CID 3286378
2-cyano-3-(3,5-dibromo-2-ethoxyphenyl)-N-(2-methyl-4-nitrophenyl)prop-2-enamide (PubChem CID 3286378) has the molecular formula C19H15Br2N3O4 and a molecular weight of 509.15 g/mol. Its IUPAC name is 2-cyano-3-(3,5-dibromo-2-ethoxyphenyl)-N-(2-methyl-4-nitrophenyl)prop-2-enamide.
| Compound Name | 2-cyano-3-(3,5-dibromo-2-ethoxyphenyl)-N-(2-methyl-4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3286378 |
| Molecular Formula | C19H15Br2N3O4 |
| Molecular Weight | 509.15 g/mol |
| Exact Mass | 506.94 |
| IUPAC Name | 2-cyano-3-(3,5-dibromo-2-ethoxyphenyl)-N-(2-methyl-4-nitrophenyl)prop-2-enamide |
| SMILES | CCOc1c(Br)cc(Br)cc1C=C(C#N)C(=O)Nc1ccc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C19H15Br2N3O4/c1-3-28-18-12(8-14(20)9-16(18)21)7-13(10-22)19(25)23-17-5-4-15(24(26)27)6-11(17)2/h4-9H,3H2,1-2H3,(H,23,25) |
| InChIKey | PRIGRFNLVWYWIB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.15 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|