C24H18Br2N2O2 — CID 126032921
(E)-2-cyano-3-(3,5-dibromo-2-phenylmethoxyphenyl)-N-(2-methylphenyl)prop-2-enamide (PubChem CID 126032921) has the molecular formula C24H18Br2N2O2 and a molecular weight of 526.23 g/mol. Its IUPAC name is (E)-2-cyano-3-(3,5-dibromo-2-phenylmethoxyphenyl)-N-(2-methylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(3,5-dibromo-2-phenylmethoxyphenyl)-N-(2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126032921 |
| Molecular Formula | C24H18Br2N2O2 |
| Molecular Weight | 526.23 g/mol |
| Exact Mass | 523.97 |
| IUPAC Name | (E)-2-cyano-3-(3,5-dibromo-2-phenylmethoxyphenyl)-N-(2-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccccc1NC(=O)/C(C#N)=C/c1cc(Br)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C24H18Br2N2O2/c1-16-7-5-6-10-22(16)28-24(29)19(14-27)11-18-12-20(25)13-21(26)23(18)30-15-17-8-3-2-4-9-17/h2-13H,15H2,1H3,(H,28,29)/b19-11+ |
| InChIKey | OBWFDYGOUHKNHC-YBFXNURJSA-N |
| XLogP | 6.64 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.23 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|