C23H15Br2FN2O2 — CID 126055107
(E)-2-cyano-3-[3,5-dibromo-2-[(4-fluorophenyl)methoxy]phenyl]-N-phenylprop-2-enamide (PubChem CID 126055107) has the molecular formula C23H15Br2FN2O2 and a molecular weight of 530.19 g/mol. Its IUPAC name is (E)-2-cyano-3-[3,5-dibromo-2-[(4-fluorophenyl)methoxy]phenyl]-N-phenylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3,5-dibromo-2-[(4-fluorophenyl)methoxy]phenyl]-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 126055107 |
| Molecular Formula | C23H15Br2FN2O2 |
| Molecular Weight | 530.19 g/mol |
| Exact Mass | 527.95 |
| IUPAC Name | (E)-2-cyano-3-[3,5-dibromo-2-[(4-fluorophenyl)methoxy]phenyl]-N-phenylprop-2-enamide |
| SMILES | N#C/C(=C\c1cc(Br)cc(Br)c1OCc1ccc(F)cc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C23H15Br2FN2O2/c24-18-11-16(10-17(13-27)23(29)28-20-4-2-1-3-5-20)22(21(25)12-18)30-14-15-6-8-19(26)9-7-15/h1-12H,14H2,(H,28,29)/b17-10+ |
| InChIKey | UOJDNZHULOFUTO-LICLKQGHSA-N |
| XLogP | 6.48 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.19 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|