C19H14Br2N2O2 — CID 126054232
(E)-2-cyano-3-(3,5-dibromo-2-prop-2-enoxyphenyl)-N-phenylprop-2-enamide (PubChem CID 126054232) has the molecular formula C19H14Br2N2O2 and a molecular weight of 462.14 g/mol. Its IUPAC name is (E)-2-cyano-3-(3,5-dibromo-2-prop-2-enoxyphenyl)-N-phenylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-(3,5-dibromo-2-prop-2-enoxyphenyl)-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 126054232 |
| Molecular Formula | C19H14Br2N2O2 |
| Molecular Weight | 462.14 g/mol |
| Exact Mass | 459.94 |
| IUPAC Name | (E)-2-cyano-3-(3,5-dibromo-2-prop-2-enoxyphenyl)-N-phenylprop-2-enamide |
| SMILES | C=CCOc1c(Br)cc(Br)cc1/C=C(\C#N)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H14Br2N2O2/c1-2-8-25-18-13(10-15(20)11-17(18)21)9-14(12-22)19(24)23-16-6-4-3-5-7-16/h2-7,9-11H,1,8H2,(H,23,24)/b14-9+ |
| InChIKey | NFBMZBUMDCNGAJ-NTEUORMPSA-N |
| XLogP | 5.32 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.14 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|