C22H14Br2N2O4S — CID 126079594
[2-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]-4,6-dibromophenyl] benzenesulfonate (PubChem CID 126079594) has the molecular formula C22H14Br2N2O4S and a molecular weight of 562.24 g/mol. Its IUPAC name is [2-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]-4,6-dibromophenyl] benzenesulfonate.
| Compound Name | [2-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]-4,6-dibromophenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126079594 |
| Molecular Formula | C22H14Br2N2O4S |
| Molecular Weight | 562.24 g/mol |
| Exact Mass | 559.90 |
| IUPAC Name | [2-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]-4,6-dibromophenyl] benzenesulfonate |
| SMILES | N#C/C(=C\c1cc(Br)cc(Br)c1OS(=O)(=O)c1ccccc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H14Br2N2O4S/c23-17-12-15(11-16(14-25)22(27)26-18-7-3-1-4-8-18)21(20(24)13-17)30-31(28,29)19-9-5-2-6-10-19/h1-13H,(H,26,27)/b16-11+ |
| InChIKey | GAUOGCKYILOAQB-LFIBNONCSA-N |
| XLogP | 5.52 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.24 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|