C24H16Br2ClN3O3 — CID 126271226
(Z)-3-[2-(2-anilino-2-oxoethoxy)-3,5-dibromophenyl]-N-(3-chlorophenyl)-2-cyanoprop-2-enamide (PubChem CID 126271226) has the molecular formula C24H16Br2ClN3O3 and a molecular weight of 589.67 g/mol. Its IUPAC name is (Z)-3-[2-(2-anilino-2-oxoethoxy)-3,5-dibromophenyl]-N-(3-chlorophenyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[2-(2-anilino-2-oxoethoxy)-3,5-dibromophenyl]-N-(3-chlorophenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 126271226 |
| Molecular Formula | C24H16Br2ClN3O3 |
| Molecular Weight | 589.67 g/mol |
| Exact Mass | 586.92 |
| IUPAC Name | (Z)-3-[2-(2-anilino-2-oxoethoxy)-3,5-dibromophenyl]-N-(3-chlorophenyl)-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/c1cc(Br)cc(Br)c1OCC(=O)Nc1ccccc1)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H16Br2ClN3O3/c25-17-10-15(9-16(13-28)24(32)30-20-8-4-5-18(27)12-20)23(21(26)11-17)33-14-22(31)29-19-6-2-1-3-7-19/h1-12H,14H2,(H,29,31)(H,30,32)/b16-9- |
| InChIKey | MKSNAYFRDDOCEB-SXGWCWSVSA-N |
| XLogP | 6.43 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.67 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|