C24H18Br2N2O5S — CID 126074075
[2,6-dibromo-4-[(E)-2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate (PubChem CID 126074075) has the molecular formula C24H18Br2N2O5S and a molecular weight of 606.29 g/mol. Its IUPAC name is [2,6-dibromo-4-[(E)-2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate.
| Compound Name | [2,6-dibromo-4-[(E)-2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126074075 |
| Molecular Formula | C24H18Br2N2O5S |
| Molecular Weight | 606.29 g/mol |
| Exact Mass | 603.93 |
| IUPAC Name | [2,6-dibromo-4-[(E)-2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate |
| SMILES | CCOc1ccc(NC(=O)/C(C#N)=C/c2cc(Br)c(OS(=O)(=O)c3ccccc3)c(Br)c2)cc1 |
| InChI | InChI=1S/C24H18Br2N2O5S/c1-2-32-19-10-8-18(9-11-19)28-24(29)17(15-27)12-16-13-21(25)23(22(26)14-16)33-34(30,31)20-6-4-3-5-7-20/h3-14H,2H2,1H3,(H,28,29)/b17-12+ |
| InChIKey | PJWIXMUDONUBCK-SFQUDFHCSA-N |
| XLogP | 5.92 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.29 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|