C20H16BrClN2O5 — CID 1269206
2-[2-bromo-6-chloro-4-[2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]phenoxy]acetic acid (PubChem CID 1269206) has the molecular formula C20H16BrClN2O5 and a molecular weight of 479.71 g/mol. Its IUPAC name is 2-[2-bromo-6-chloro-4-[2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-6-chloro-4-[2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 1269206 |
| Molecular Formula | C20H16BrClN2O5 |
| Molecular Weight | 479.71 g/mol |
| Exact Mass | 477.99 |
| IUPAC Name | 2-[2-bromo-6-chloro-4-[2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]phenoxy]acetic acid |
| SMILES | CCOc1ccc(NC(=O)C(C#N)=Cc2cc(Cl)c(OCC(=O)O)c(Br)c2)cc1 |
| InChI | InChI=1S/C20H16BrClN2O5/c1-2-28-15-5-3-14(4-6-15)24-20(27)13(10-23)7-12-8-16(21)19(17(22)9-12)29-11-18(25)26/h3-9H,2,11H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | BWHBFUGEELPDJV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.71 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|