C22H14Cl2N2O5S — CID 126078705
[2,4-dichloro-6-[(E)-2-cyano-3-(4-hydroxyanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate (PubChem CID 126078705) has the molecular formula C22H14Cl2N2O5S and a molecular weight of 489.34 g/mol. Its IUPAC name is [2,4-dichloro-6-[(E)-2-cyano-3-(4-hydroxyanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate.
| Compound Name | [2,4-dichloro-6-[(E)-2-cyano-3-(4-hydroxyanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126078705 |
| Molecular Formula | C22H14Cl2N2O5S |
| Molecular Weight | 489.34 g/mol |
| Exact Mass | 488.00 |
| IUPAC Name | [2,4-dichloro-6-[(E)-2-cyano-3-(4-hydroxyanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate |
| SMILES | N#C/C(=C\c1cc(Cl)cc(Cl)c1OS(=O)(=O)c1ccccc1)C(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C22H14Cl2N2O5S/c23-16-11-14(10-15(13-25)22(28)26-17-6-8-18(27)9-7-17)21(20(24)12-16)31-32(29,30)19-4-2-1-3-5-19/h1-12,27H,(H,26,28)/b15-10+ |
| InChIKey | NBESZKALUVFLOA-XNTDXEJSSA-N |
| XLogP | 5.01 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.34 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|