C22H15ClN2O5S — CID 126081829
[4-chloro-2-[(E)-2-cyano-3-(4-hydroxyanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate (PubChem CID 126081829) has the molecular formula C22H15ClN2O5S and a molecular weight of 454.89 g/mol. Its IUPAC name is [4-chloro-2-[(E)-2-cyano-3-(4-hydroxyanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate.
| Compound Name | [4-chloro-2-[(E)-2-cyano-3-(4-hydroxyanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126081829 |
| Molecular Formula | C22H15ClN2O5S |
| Molecular Weight | 454.89 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | [4-chloro-2-[(E)-2-cyano-3-(4-hydroxyanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate |
| SMILES | N#C/C(=C\c1cc(Cl)ccc1OS(=O)(=O)c1ccccc1)C(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C22H15ClN2O5S/c23-17-6-11-21(30-31(28,29)20-4-2-1-3-5-20)15(13-17)12-16(14-24)22(27)25-18-7-9-19(26)10-8-18/h1-13,26H,(H,25,27)/b16-12+ |
| InChIKey | YYTLFLXINBEMMR-FOWTUZBSSA-N |
| XLogP | 4.36 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.89 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|