C22H16N2O5S — CID 126075966
[4-[(E)-2-cyano-3-(4-hydroxyanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate (PubChem CID 126075966) has the molecular formula C22H16N2O5S and a molecular weight of 420.45 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-(4-hydroxyanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate.
| Compound Name | [4-[(E)-2-cyano-3-(4-hydroxyanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126075966 |
| Molecular Formula | C22H16N2O5S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | [4-[(E)-2-cyano-3-(4-hydroxyanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate |
| SMILES | N#C/C(=C\c1ccc(OS(=O)(=O)c2ccccc2)cc1)C(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C22H16N2O5S/c23-15-17(22(26)24-18-8-10-19(25)11-9-18)14-16-6-12-20(13-7-16)29-30(27,28)21-4-2-1-3-5-21/h1-14,25H,(H,24,26)/b17-14+ |
| InChIKey | WDSIRHTUCMSRAK-SAPNQHFASA-N |
| XLogP | 3.71 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|