C22H14ClN3O6S — CID 3478562
[4-[3-(4-chloroanilino)-2-cyano-3-oxoprop-1-enyl]phenyl] 4-nitrobenzenesulfonate (PubChem CID 3478562) has the molecular formula C22H14ClN3O6S and a molecular weight of 483.89 g/mol. Its IUPAC name is [4-[3-(4-chloroanilino)-2-cyano-3-oxoprop-1-enyl]phenyl] 4-nitrobenzenesulfonate.
| Compound Name | [4-[3-(4-chloroanilino)-2-cyano-3-oxoprop-1-enyl]phenyl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 3478562 |
| Molecular Formula | C22H14ClN3O6S |
| Molecular Weight | 483.89 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | [4-[3-(4-chloroanilino)-2-cyano-3-oxoprop-1-enyl]phenyl] 4-nitrobenzenesulfonate |
| SMILES | N#CC(=Cc1ccc(OS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H14ClN3O6S/c23-17-3-5-18(6-4-17)25-22(27)16(14-24)13-15-1-9-20(10-2-15)32-33(30,31)21-11-7-19(8-12-21)26(28)29/h1-13H,(H,25,27) |
| InChIKey | AKYFMJNEGACIPV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 139.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.89 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|