C24H17ClN2O6S — CID 126078360
methyl 4-[[(Z)-3-[3-(4-chlorophenyl)sulfonyloxyphenyl]-2-cyanoprop-2-enoyl]amino]benzoate (PubChem CID 126078360) has the molecular formula C24H17ClN2O6S and a molecular weight of 496.93 g/mol. Its IUPAC name is methyl 4-[[(Z)-3-[3-(4-chlorophenyl)sulfonyloxyphenyl]-2-cyanoprop-2-enoyl]amino]benzoate.
| Compound Name | methyl 4-[[(Z)-3-[3-(4-chlorophenyl)sulfonyloxyphenyl]-2-cyanoprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 126078360 |
| Molecular Formula | C24H17ClN2O6S |
| Molecular Weight | 496.93 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | methyl 4-[[(Z)-3-[3-(4-chlorophenyl)sulfonyloxyphenyl]-2-cyanoprop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)/C(C#N)=C\c2cccc(OS(=O)(=O)c3ccc(Cl)cc3)c2)cc1 |
| InChI | InChI=1S/C24H17ClN2O6S/c1-32-24(29)17-5-9-20(10-6-17)27-23(28)18(15-26)13-16-3-2-4-21(14-16)33-34(30,31)22-11-7-19(25)8-12-22/h2-14H,1H3,(H,27,28)/b18-13- |
| InChIKey | ACUYJBGTZUMKRQ-AQTBWJFISA-N |
| XLogP | 4.44 |
| TPSA | 122.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.93 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|