C26H17IN2O4S — CID 3447643
[3-[2-cyano-3-(4-iodoanilino)-3-oxoprop-1-enyl]phenyl] naphthalene-2-sulfonate (PubChem CID 3447643) has the molecular formula C26H17IN2O4S and a molecular weight of 580.40 g/mol. Its IUPAC name is [3-[2-cyano-3-(4-iodoanilino)-3-oxoprop-1-enyl]phenyl] naphthalene-2-sulfonate.
| Compound Name | [3-[2-cyano-3-(4-iodoanilino)-3-oxoprop-1-enyl]phenyl] naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 3447643 |
| Molecular Formula | C26H17IN2O4S |
| Molecular Weight | 580.40 g/mol |
| Exact Mass | 580.00 |
| IUPAC Name | [3-[2-cyano-3-(4-iodoanilino)-3-oxoprop-1-enyl]phenyl] naphthalene-2-sulfonate |
| SMILES | N#CC(=Cc1cccc(OS(=O)(=O)c2ccc3ccccc3c2)c1)C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C26H17IN2O4S/c27-22-9-11-23(12-10-22)29-26(30)21(17-28)14-18-4-3-7-24(15-18)33-34(31,32)25-13-8-19-5-1-2-6-20(19)16-25/h1-16H,(H,29,30) |
| InChIKey | WLQSWTAEMCHRRS-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.40 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|