C29H22ClN3O6S2 — CID 4015003
[3-[2-cyano-3-[4-[(4-methylphenyl)sulfamoyl]anilino]-3-oxoprop-1-enyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 4015003) has the molecular formula C29H22ClN3O6S2 and a molecular weight of 608.10 g/mol. Its IUPAC name is [3-[2-cyano-3-[4-[(4-methylphenyl)sulfamoyl]anilino]-3-oxoprop-1-enyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [3-[2-cyano-3-[4-[(4-methylphenyl)sulfamoyl]anilino]-3-oxoprop-1-enyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 4015003 |
| Molecular Formula | C29H22ClN3O6S2 |
| Molecular Weight | 608.10 g/mol |
| Exact Mass | 607.06 |
| IUPAC Name | [3-[2-cyano-3-[4-[(4-methylphenyl)sulfamoyl]anilino]-3-oxoprop-1-enyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=O)C(C#N)=Cc3cccc(OS(=O)(=O)c4ccc(Cl)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C29H22ClN3O6S2/c1-20-5-9-25(10-6-20)33-40(35,36)27-15-11-24(12-16-27)32-29(34)22(19-31)17-21-3-2-4-26(18-21)39-41(37,38)28-13-7-23(30)8-14-28/h2-18,33H,1H3,(H,32,34) |
| InChIKey | FJRAYXQPFHWNHJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 142.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.10 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|