C24H18BrClN2O6S — CID 126078826
[2-bromo-4-[(E)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]-6-methoxyphenyl] 4-chlorobenzenesulfonate (PubChem CID 126078826) has the molecular formula C24H18BrClN2O6S and a molecular weight of 577.84 g/mol. Its IUPAC name is [2-bromo-4-[(E)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]-6-methoxyphenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-bromo-4-[(E)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]-6-methoxyphenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126078826 |
| Molecular Formula | C24H18BrClN2O6S |
| Molecular Weight | 577.84 g/mol |
| Exact Mass | 575.98 |
| IUPAC Name | [2-bromo-4-[(E)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]-6-methoxyphenyl] 4-chlorobenzenesulfonate |
| SMILES | COc1ccc(NC(=O)/C(C#N)=C/c2cc(Br)c(OS(=O)(=O)c3ccc(Cl)cc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H18BrClN2O6S/c1-32-19-7-5-18(6-8-19)28-24(29)16(14-27)11-15-12-21(25)23(22(13-15)33-2)34-35(30,31)20-9-3-17(26)4-10-20/h3-13H,1-2H3,(H,28,29)/b16-11+ |
| InChIKey | NOULIYRSINEXOB-LFIBNONCSA-N |
| XLogP | 5.43 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.84 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|