C23H18N2O5S — CID 126077591
[3-[(Z)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate (PubChem CID 126077591) has the molecular formula C23H18N2O5S and a molecular weight of 434.47 g/mol. Its IUPAC name is [3-[(Z)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate.
| Compound Name | [3-[(Z)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126077591 |
| Molecular Formula | C23H18N2O5S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | [3-[(Z)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate |
| SMILES | COc1ccc(NC(=O)/C(C#N)=C\c2cccc(OS(=O)(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C23H18N2O5S/c1-29-20-12-10-19(11-13-20)25-23(26)18(16-24)14-17-6-5-7-21(15-17)30-31(27,28)22-8-3-2-4-9-22/h2-15H,1H3,(H,25,26)/b18-14- |
| InChIKey | GAAAXWCXPKGTJU-JXAWBTAJSA-N |
| XLogP | 4.01 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|