C31H17ClN2O5 — CID 3143721
[3-[2-cyano-3-[(9,10-dioxoanthracen-2-yl)amino]-3-oxoprop-1-enyl]phenyl] 4-chlorobenzoate (PubChem CID 3143721) has the molecular formula C31H17ClN2O5 and a molecular weight of 532.94 g/mol. Its IUPAC name is [3-[2-cyano-3-[(9,10-dioxoanthracen-2-yl)amino]-3-oxoprop-1-enyl]phenyl] 4-chlorobenzoate.
| Compound Name | [3-[2-cyano-3-[(9,10-dioxoanthracen-2-yl)amino]-3-oxoprop-1-enyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 3143721 |
| Molecular Formula | C31H17ClN2O5 |
| Molecular Weight | 532.94 g/mol |
| Exact Mass | 532.08 |
| IUPAC Name | [3-[2-cyano-3-[(9,10-dioxoanthracen-2-yl)amino]-3-oxoprop-1-enyl]phenyl] 4-chlorobenzoate |
| SMILES | N#CC(=Cc1cccc(OC(=O)c2ccc(Cl)cc2)c1)C(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C31H17ClN2O5/c32-21-10-8-19(9-11-21)31(38)39-23-5-3-4-18(15-23)14-20(17-33)30(37)34-22-12-13-26-27(16-22)29(36)25-7-2-1-6-24(25)28(26)35/h1-16H,(H,34,37) |
| InChIKey | ZAJIXURAHFYNGP-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.94 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|