C27H18N4O4 — CID 3143723
2-cyano-3-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-N-(9,10-dioxoanthracen-2-yl)prop-2-enamide (PubChem CID 3143723) has the molecular formula C27H18N4O4 and a molecular weight of 462.47 g/mol. Its IUPAC name is 2-cyano-3-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-N-(9,10-dioxoanthracen-2-yl)prop-2-enamide.
| Compound Name | 2-cyano-3-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-N-(9,10-dioxoanthracen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3143723 |
| Molecular Formula | C27H18N4O4 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 2-cyano-3-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-N-(9,10-dioxoanthracen-2-yl)prop-2-enamide |
| SMILES | Cn1c(=O)n(C)c2cc(C=C(C#N)C(=O)Nc3ccc4c(c3)C(=O)c3ccccc3C4=O)ccc21 |
| InChI | InChI=1S/C27H18N4O4/c1-30-22-10-7-15(12-23(22)31(2)27(30)35)11-16(14-28)26(34)29-17-8-9-20-21(13-17)25(33)19-6-4-3-5-18(19)24(20)32/h3-13H,1-2H3,(H,29,34) |
| InChIKey | JELANFPOKQMIEC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|