C22H18N2O4 — CID 18530614
(Z)-2-cyano-3-(4-hydroxy-3,5-dimethoxyphenyl)-N-naphthalen-2-ylprop-2-enamide (PubChem CID 18530614) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is (Z)-2-cyano-3-(4-hydroxy-3,5-dimethoxyphenyl)-N-naphthalen-2-ylprop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(4-hydroxy-3,5-dimethoxyphenyl)-N-naphthalen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 18530614 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | (Z)-2-cyano-3-(4-hydroxy-3,5-dimethoxyphenyl)-N-naphthalen-2-ylprop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2ccc3ccccc3c2)cc(OC)c1O |
| InChI | InChI=1S/C22H18N2O4/c1-27-19-10-14(11-20(28-2)21(19)25)9-17(13-23)22(26)24-18-8-7-15-5-3-4-6-16(15)12-18/h3-12,25H,1-2H3,(H,24,26)/b17-9- |
| InChIKey | OAFUTJDITWBJDP-MFOYZWKCSA-N |
| XLogP | 4.11 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|