C19H15N3O3S — CID 126048051
[5-[(Z)-2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]-2-hydroxy-3-methoxyphenyl] thiocyanate (PubChem CID 126048051) has the molecular formula C19H15N3O3S and a molecular weight of 365.41 g/mol. Its IUPAC name is [5-[(Z)-2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]-2-hydroxy-3-methoxyphenyl] thiocyanate.
| Compound Name | [5-[(Z)-2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]-2-hydroxy-3-methoxyphenyl] thiocyanate |
|---|---|
| PubChem CID | 126048051 |
| Molecular Formula | C19H15N3O3S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | [5-[(Z)-2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]-2-hydroxy-3-methoxyphenyl] thiocyanate |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2ccc(C)cc2)cc(SC#N)c1O |
| InChI | InChI=1S/C19H15N3O3S/c1-12-3-5-15(6-4-12)22-19(24)14(10-20)7-13-8-16(25-2)18(23)17(9-13)26-11-21/h3-9,23H,1-2H3,(H,22,24)/b14-7- |
| InChIKey | KEFUHUUWIJGKDD-AUWJEWJLSA-N |
| XLogP | 3.83 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|