C17H12BrFN2O3 — CID 2594962
(Z)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)-2-cyano-N-(4-fluorophenyl)prop-2-enamide (PubChem CID 2594962) has the molecular formula C17H12BrFN2O3 and a molecular weight of 391.20 g/mol. Its IUPAC name is (Z)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)-2-cyano-N-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (Z)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)-2-cyano-N-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2594962 |
| Molecular Formula | C17H12BrFN2O3 |
| Molecular Weight | 391.20 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | (Z)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)-2-cyano-N-(4-fluorophenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2ccc(F)cc2)cc(Br)c1O |
| InChI | InChI=1S/C17H12BrFN2O3/c1-24-15-8-10(7-14(18)16(15)22)6-11(9-20)17(23)21-13-4-2-12(19)3-5-13/h2-8,22H,1H3,(H,21,23)/b11-6- |
| InChIKey | ZEJJECGHLAQCTD-WDZFZDKYSA-N |
| XLogP | 3.85 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.20 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|