C17H11BrCl2N2O3 — CID 4542372
3-(3-bromo-4-hydroxy-5-methoxyphenyl)-2-cyano-N-(2,6-dichlorophenyl)prop-2-enamide (PubChem CID 4542372) has the molecular formula C17H11BrCl2N2O3 and a molecular weight of 442.10 g/mol. Its IUPAC name is 3-(3-bromo-4-hydroxy-5-methoxyphenyl)-2-cyano-N-(2,6-dichlorophenyl)prop-2-enamide.
| Compound Name | 3-(3-bromo-4-hydroxy-5-methoxyphenyl)-2-cyano-N-(2,6-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4542372 |
| Molecular Formula | C17H11BrCl2N2O3 |
| Molecular Weight | 442.10 g/mol |
| Exact Mass | 439.93 |
| IUPAC Name | 3-(3-bromo-4-hydroxy-5-methoxyphenyl)-2-cyano-N-(2,6-dichlorophenyl)prop-2-enamide |
| SMILES | COc1cc(C=C(C#N)C(=O)Nc2c(Cl)cccc2Cl)cc(Br)c1O |
| InChI | InChI=1S/C17H11BrCl2N2O3/c1-25-14-7-9(6-11(18)16(14)23)5-10(8-21)17(24)22-15-12(19)3-2-4-13(15)20/h2-7,23H,1H3,(H,22,24) |
| InChIKey | KJEGXSUMJRBQFJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.10 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|