C18H13BrCl2N2O3 — CID 2713839
(E)-3-(2-bromo-4,5-dimethoxyphenyl)-2-cyano-N-(2,6-dichlorophenyl)prop-2-enamide (PubChem CID 2713839) has the molecular formula C18H13BrCl2N2O3 and a molecular weight of 456.12 g/mol. Its IUPAC name is (E)-3-(2-bromo-4,5-dimethoxyphenyl)-2-cyano-N-(2,6-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-3-(2-bromo-4,5-dimethoxyphenyl)-2-cyano-N-(2,6-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2713839 |
| Molecular Formula | C18H13BrCl2N2O3 |
| Molecular Weight | 456.12 g/mol |
| Exact Mass | 453.95 |
| IUPAC Name | (E)-3-(2-bromo-4,5-dimethoxyphenyl)-2-cyano-N-(2,6-dichlorophenyl)prop-2-enamide |
| SMILES | COc1cc(Br)c(/C=C(\C#N)C(=O)Nc2c(Cl)cccc2Cl)cc1OC |
| InChI | InChI=1S/C18H13BrCl2N2O3/c1-25-15-7-10(12(19)8-16(15)26-2)6-11(9-22)18(24)23-17-13(20)4-3-5-14(17)21/h3-8H,1-2H3,(H,23,24)/b11-6+ |
| InChIKey | LZHUNNATDPMLEO-IZZDOVSWSA-N |
| XLogP | 5.32 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.12 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|