C25H17BrCl2N2O5 — CID 124534656
4-[[5-bromo-4-[(Z)-2-cyano-3-(2,3-dichloroanilino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]benzoic acid (PubChem CID 124534656) has the molecular formula C25H17BrCl2N2O5 and a molecular weight of 576.23 g/mol. Its IUPAC name is 4-[[5-bromo-4-[(Z)-2-cyano-3-(2,3-dichloroanilino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[5-bromo-4-[(Z)-2-cyano-3-(2,3-dichloroanilino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 124534656 |
| Molecular Formula | C25H17BrCl2N2O5 |
| Molecular Weight | 576.23 g/mol |
| Exact Mass | 573.97 |
| IUPAC Name | 4-[[5-bromo-4-[(Z)-2-cyano-3-(2,3-dichloroanilino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2cccc(Cl)c2Cl)c(Br)cc1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H17BrCl2N2O5/c1-34-21-10-16(9-17(12-29)24(31)30-20-4-2-3-19(27)23(20)28)18(26)11-22(21)35-13-14-5-7-15(8-6-14)25(32)33/h2-11H,13H2,1H3,(H,30,31)(H,32,33)/b17-9- |
| InChIKey | FDLYQDKNOQUJPX-MFOYZWKCSA-N |
| XLogP | 6.59 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.23 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|