C26H19BrCl2N2O5 — CID 124534725
(Z)-3-[4-(1,3-benzodioxol-5-ylmethoxy)-2-bromo-5-ethoxyphenyl]-2-cyano-N-(2,3-dichlorophenyl)prop-2-enamide (PubChem CID 124534725) has the molecular formula C26H19BrCl2N2O5 and a molecular weight of 590.26 g/mol. Its IUPAC name is (Z)-3-[4-(1,3-benzodioxol-5-ylmethoxy)-2-bromo-5-ethoxyphenyl]-2-cyano-N-(2,3-dichlorophenyl)prop-2-enamide.
| Compound Name | (Z)-3-[4-(1,3-benzodioxol-5-ylmethoxy)-2-bromo-5-ethoxyphenyl]-2-cyano-N-(2,3-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 124534725 |
| Molecular Formula | C26H19BrCl2N2O5 |
| Molecular Weight | 590.26 g/mol |
| Exact Mass | 587.99 |
| IUPAC Name | (Z)-3-[4-(1,3-benzodioxol-5-ylmethoxy)-2-bromo-5-ethoxyphenyl]-2-cyano-N-(2,3-dichlorophenyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2cccc(Cl)c2Cl)c(Br)cc1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H19BrCl2N2O5/c1-2-33-23-10-16(9-17(12-30)26(32)31-20-5-3-4-19(28)25(20)29)18(27)11-24(23)34-13-15-6-7-21-22(8-15)36-14-35-21/h3-11H,2,13-14H2,1H3,(H,31,32)/b17-9- |
| InChIKey | FQSGBZPHQSCKRU-MFOYZWKCSA-N |
| XLogP | 7.01 |
| TPSA | 89.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.26 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|