C19H14Cl2N2O4 — CID 126106524
(E)-2-cyano-N-(2,4-dichlorophenyl)-3-(6-ethoxy-1,3-benzodioxol-5-yl)prop-2-enamide (PubChem CID 126106524) has the molecular formula C19H14Cl2N2O4 and a molecular weight of 405.24 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,4-dichlorophenyl)-3-(6-ethoxy-1,3-benzodioxol-5-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,4-dichlorophenyl)-3-(6-ethoxy-1,3-benzodioxol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 126106524 |
| Molecular Formula | C19H14Cl2N2O4 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | (E)-2-cyano-N-(2,4-dichlorophenyl)-3-(6-ethoxy-1,3-benzodioxol-5-yl)prop-2-enamide |
| SMILES | CCOc1cc2c(cc1/C=C(\C#N)C(=O)Nc1ccc(Cl)cc1Cl)OCO2 |
| InChI | InChI=1S/C19H14Cl2N2O4/c1-2-25-16-8-18-17(26-10-27-18)6-11(16)5-12(9-22)19(24)23-15-4-3-13(20)7-14(15)21/h3-8H,2,10H2,1H3,(H,23,24)/b12-5+ |
| InChIKey | VJHFPQCXHFOIMV-LFYBBSHMSA-N |
| XLogP | 4.67 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|