C18H13ClN2O4 — CID 112979324
(E)-N-(1,3-benzodioxol-5-yl)-3-(5-chloro-2-methoxyphenyl)-2-cyanoprop-2-enamide (PubChem CID 112979324) has the molecular formula C18H13ClN2O4 and a molecular weight of 356.77 g/mol. Its IUPAC name is (E)-N-(1,3-benzodioxol-5-yl)-3-(5-chloro-2-methoxyphenyl)-2-cyanoprop-2-enamide.
| Compound Name | (E)-N-(1,3-benzodioxol-5-yl)-3-(5-chloro-2-methoxyphenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 112979324 |
| Molecular Formula | C18H13ClN2O4 |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | (E)-N-(1,3-benzodioxol-5-yl)-3-(5-chloro-2-methoxyphenyl)-2-cyanoprop-2-enamide |
| SMILES | COc1ccc(Cl)cc1/C=C(\C#N)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H13ClN2O4/c1-23-15-4-2-13(19)7-11(15)6-12(9-20)18(22)21-14-3-5-16-17(8-14)25-10-24-16/h2-8H,10H2,1H3,(H,21,22)/b12-6+ |
| InChIKey | SLEHIXAAOGMPSN-WUXMJOGZSA-N |
| XLogP | 3.62 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|