C23H23N3O4S — CID 73383162
N-(1,3-benzodioxol-5-yl)-2-cyano-3-[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]prop-2-enamide (PubChem CID 73383162) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-cyano-3-[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]prop-2-enamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-cyano-3-[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 73383162 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-cyano-3-[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]prop-2-enamide |
| SMILES | COc1ccc(C=C(C#N)C(=O)Nc2ccc3c(c2)OCO3)cc1CN1CCSCC1 |
| InChI | InChI=1S/C23H23N3O4S/c1-28-20-4-2-16(11-18(20)14-26-6-8-31-9-7-26)10-17(13-24)23(27)25-19-3-5-21-22(12-19)30-15-29-21/h2-5,10-12H,6-9,14-15H2,1H3,(H,25,27) |
| InChIKey | YOVYNDLCAIKNTE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|