C28H18N4O6 — CID 139225054
(E)-3-(1,3-benzodioxol-5-yl)-N-[4-[[(E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoyl]amino]phenyl]-2-cyanoprop-2-enamide (PubChem CID 139225054) has the molecular formula C28H18N4O6 and a molecular weight of 506.47 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[4-[[(E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoyl]amino]phenyl]-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[4-[[(E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoyl]amino]phenyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 139225054 |
| Molecular Formula | C28H18N4O6 |
| Molecular Weight | 506.47 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[4-[[(E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoyl]amino]phenyl]-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C\c1ccc2c(c1)OCO2)C(=O)Nc1ccc(NC(=O)/C(C#N)=C/c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C28H18N4O6/c29-13-19(9-17-1-7-23-25(11-17)37-15-35-23)27(33)31-21-3-5-22(6-4-21)32-28(34)20(14-30)10-18-2-8-24-26(12-18)38-16-36-24/h1-12H,15-16H2,(H,31,33)(H,32,34)/b19-9+,20-10+ |
| InChIKey | BQVTWKXQHGUFFK-LQGKIZFRSA-N |
| XLogP | 4.24 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|