C14H9N3O3S — CID 6212254
(E)-3-(1,3-benzodioxol-5-yl)-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 6212254) has the molecular formula C14H9N3O3S and a molecular weight of 299.31 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 6212254 |
| Molecular Formula | C14H9N3O3S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc2c(c1)OCO2)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C14H9N3O3S/c15-7-10(13(18)17-14-16-3-4-21-14)5-9-1-2-11-12(6-9)20-8-19-11/h1-6H,8H2,(H,16,17,18)/b10-5+ |
| InChIKey | RUUUZDWHWKLSEM-BJMVGYQFSA-N |
| XLogP | 2.42 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|