C14H8ClN3O3S — CID 9211056
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 9211056) has the molecular formula C14H8ClN3O3S and a molecular weight of 333.76 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9211056 |
| Molecular Formula | C14H8ClN3O3S |
| Molecular Weight | 333.76 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | N#C/C(=C\c1cc(Cl)c2c(c1)OCO2)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C14H8ClN3O3S/c15-10-4-8(5-11-12(10)21-7-20-11)3-9(6-16)13(19)18-14-17-1-2-22-14/h1-5H,7H2,(H,17,18,19)/b9-3+ |
| InChIKey | PKEPPCKQDDHIGE-YCRREMRBSA-N |
| XLogP | 3.07 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.76 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|