C23H20ClN3O3S — CID 170913845
(Z)-3-[3-chloro-4-[2-(2,4-dimethylphenoxy)ethoxy]phenyl]-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 170913845) has the molecular formula C23H20ClN3O3S and a molecular weight of 453.95 g/mol. Its IUPAC name is (Z)-3-[3-chloro-4-[2-(2,4-dimethylphenoxy)ethoxy]phenyl]-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-[3-chloro-4-[2-(2,4-dimethylphenoxy)ethoxy]phenyl]-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170913845 |
| Molecular Formula | C23H20ClN3O3S |
| Molecular Weight | 453.95 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | (Z)-3-[3-chloro-4-[2-(2,4-dimethylphenoxy)ethoxy]phenyl]-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | Cc1ccc(OCCOc2ccc(/C=C(/C#N)C(=O)Nc3nccs3)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C23H20ClN3O3S/c1-15-3-5-20(16(2)11-15)29-8-9-30-21-6-4-17(13-19(21)24)12-18(14-25)22(28)27-23-26-7-10-31-23/h3-7,10-13H,8-9H2,1-2H3,(H,26,27,28)/b18-12- |
| InChIKey | RDNUOEJVUVATCK-PDGQHHTCSA-N |
| XLogP | 5.42 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.95 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|