C29H26N4O4S — CID 171331558
2-cyano-3-[4-[2-(2,4-dimethylphenoxy)ethoxy]phenyl]-N-[5-(phenoxymethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 171331558) has the molecular formula C29H26N4O4S and a molecular weight of 526.62 g/mol. Its IUPAC name is 2-cyano-3-[4-[2-(2,4-dimethylphenoxy)ethoxy]phenyl]-N-[5-(phenoxymethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | 2-cyano-3-[4-[2-(2,4-dimethylphenoxy)ethoxy]phenyl]-N-[5-(phenoxymethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 171331558 |
| Molecular Formula | C29H26N4O4S |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 2-cyano-3-[4-[2-(2,4-dimethylphenoxy)ethoxy]phenyl]-N-[5-(phenoxymethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | Cc1ccc(OCCOc2ccc(C=C(C#N)C(=O)Nc3nnc(COc4ccccc4)s3)cc2)c(C)c1 |
| InChI | InChI=1S/C29H26N4O4S/c1-20-8-13-26(21(2)16-20)36-15-14-35-25-11-9-22(10-12-25)17-23(18-30)28(34)31-29-33-32-27(38-29)19-37-24-6-4-3-5-7-24/h3-13,16-17H,14-15,19H2,1-2H3,(H,31,33,34) |
| InChIKey | CGIMIGQCTRYCDP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|