C28H24N4O3S — CID 170910585
(Z)-N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-cyano-3-[4-[2-(2-methylphenoxy)ethoxy]phenyl]prop-2-enamide (PubChem CID 170910585) has the molecular formula C28H24N4O3S and a molecular weight of 496.59 g/mol. Its IUPAC name is (Z)-N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-cyano-3-[4-[2-(2-methylphenoxy)ethoxy]phenyl]prop-2-enamide.
| Compound Name | (Z)-N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-cyano-3-[4-[2-(2-methylphenoxy)ethoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 170910585 |
| Molecular Formula | C28H24N4O3S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | (Z)-N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-cyano-3-[4-[2-(2-methylphenoxy)ethoxy]phenyl]prop-2-enamide |
| SMILES | Cc1ccccc1OCCOc1ccc(/C=C(/C#N)C(=O)Nc2nnc(Cc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C28H24N4O3S/c1-20-7-5-6-10-25(20)35-16-15-34-24-13-11-22(12-14-24)17-23(19-29)27(33)30-28-32-31-26(36-28)18-21-8-3-2-4-9-21/h2-14,17H,15-16,18H2,1H3,(H,30,32,33)/b23-17- |
| InChIKey | XKOWTGAXUMOYDG-QJOMJCCJSA-N |
| XLogP | 5.44 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|