C22H20N4O3S2 — CID 170916701
(Z)-2-cyano-3-[4-[2-(2-methylphenoxy)ethoxy]phenyl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 170916701) has the molecular formula C22H20N4O3S2 and a molecular weight of 452.56 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-[2-(2-methylphenoxy)ethoxy]phenyl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-[2-(2-methylphenoxy)ethoxy]phenyl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170916701 |
| Molecular Formula | C22H20N4O3S2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | (Z)-2-cyano-3-[4-[2-(2-methylphenoxy)ethoxy]phenyl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | CSc1nsc(NC(=O)/C(C#N)=C\c2ccc(OCCOc3ccccc3C)cc2)n1 |
| InChI | InChI=1S/C22H20N4O3S2/c1-15-5-3-4-6-19(15)29-12-11-28-18-9-7-16(8-10-18)13-17(14-23)20(27)24-21-25-22(30-2)26-31-21/h3-10,13H,11-12H2,1-2H3,(H,24,25,26,27)/b17-13- |
| InChIKey | NDJNWZQRZLENFM-LGMDPLHJSA-N |
| XLogP | 4.57 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|